FL3FCBNM0002
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5-Hydroxy-7-methoxy-2- (4-methoxyphenyl) -6,8-dimethyl-4H-1-benzopyran-4-one |
| − | |Common Name= | + | |Common Name=&&4',7-Dimethoxy-6,8-dimethyl-5-hydroxyflavone&&Eucalyptin&&5-Hydroxy-7-methoxy-2- (4-methoxyphenyl) -6,8-dimethyl-4H-1-benzopyran-4-one&& |
|CAS=3122-88-1 | |CAS=3122-88-1 | ||
|KNApSAcK=C00003991 | |KNApSAcK=C00003991 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FCB Apigenin 7,4'-dimethyl ether (11 pages) : FL3FCBNM C-Methyl or C2/C3 substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3122-88-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCBNM0002.mol |
| 4',7-Dimethoxy-6,8-dimethyl-5-hydroxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-7-methoxy-2- (4-methoxyphenyl) -6,8-dimethyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O5 |
| Exact Mass | 326.115423686 |
| Average Mass | 326.34322000000003 |
| SMILES | c(C(O2)=CC(c(c3O)c2c(c(c3C)OC)C)=O)(c1)ccc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
