FL3FCANM0002
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5-Hydroxy-2- (4-hydroxyphenyl) -7-methoxy-6-methyl-4H-1-benzopyran-4-one |
| − | |Common Name=&&8-Demethylsideroxylin&&5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-methyl-4H-1-benzopyran-4-one&& | + | |Common Name=&&8-Demethylsideroxylin&&5-Hydroxy-2- (4-hydroxyphenyl) -7-methoxy-6-methyl-4H-1-benzopyran-4-one&& |
|CAS=80621-54-1 | |CAS=80621-54-1 | ||
|KNApSAcK=C00013597 | |KNApSAcK=C00013597 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FCA Genkwanin (48 pages) : FL3FCANM C-Methyl or C2/C3 substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 80621-54-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCANM0002.mol |
| 8-Demethylsideroxylin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2- (4-hydroxyphenyl) -7-methoxy-6-methyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O5 |
| Exact Mass | 298.084123558 |
| Average Mass | 298.29006 |
| SMILES | COc(c1)c(C)c(O)c(C(=O)3)c1OC(=C3)c(c2)ccc(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
