FL3FCADS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,4'-Dihydroxy-7-methoxyflavone 8-C-glucoside-4'-O-glucoside |
|Common Name=&&Isoswertisin 4'-O-glucoside&& | |Common Name=&&Isoswertisin 4'-O-glucoside&& | ||
|CAS=35480-14-9 | |CAS=35480-14-9 | ||
|KNApSAcK=C00006276 | |KNApSAcK=C00006276 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 35480-14-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCADS0003.mol |
| Isoswertisin 4'-O-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-7-methoxyflavone 8-C-glucoside-4'-O-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C28H32O15 |
| Exact Mass | 608.174120354 |
| Average Mass | 608.54468 |
| SMILES | C(=O)(c12)C=C(c(c5)ccc(c5)OC(O4)C(O)C(O)C(C4CO)O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
