FL3FALNP0012
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=(+)-3,8-Dihydroxy-11,11-dimethyl-6-(2-methyl-1-propenyl)-6H,7H,11H-bis[1]benzopyrano[4,3-b:6',7'-e]pyran-7-one |
|Common Name=&&Isocyclomorusin&&(+)-3,8-Dihydroxy-11,11-dimethyl-6-(2-methyl-1-propenyl)-6H,7H,11H-bis[1]benzopyrano[4,3-b:6',7'-e]pyran-7-one&& | |Common Name=&&Isocyclomorusin&&(+)-3,8-Dihydroxy-11,11-dimethyl-6-(2-methyl-1-propenyl)-6H,7H,11H-bis[1]benzopyrano[4,3-b:6',7'-e]pyran-7-one&& | ||
|CAS=152186-78-2 | |CAS=152186-78-2 | ||
|KNApSAcK=C00004098 | |KNApSAcK=C00004098 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 152186-78-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FALNP0012.mol |
| Isocyclomorusin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (+)-3,8-Dihydroxy-11,11-dimethyl-6-(2-methyl-1-propenyl)-6H,7H,11H-bis[1]benzopyrano[4,3-b:6',7'-e]pyran-7-one |
| Common Name |
|
| Symbol | |
| Formula | C25H22O6 |
| Exact Mass | 418.141638436 |
| Average Mass | 418.43858 |
| SMILES | c(c32)(C(C(C(C=C(C)C)4)=C(c(c5)c(cc(O)c5)O4)O3)=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
