FL3FALNI0019
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5-Hydroxy-2-(4-hydroxy-2-methoxyphenyl)-7-methoxy-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName=5-Hydroxy-2- (4-hydroxy-2-methoxyphenyl) -7-methoxy-8- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Artocarpetin B&&5-Hydroxy-2-(4-hydroxy-2-methoxyphenyl)-7-methoxy-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Artocarpetin B&&5-Hydroxy-2- (4-hydroxy-2-methoxyphenyl) -7-methoxy-8- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=170894-22-1 | |CAS=170894-22-1 | ||
|KNApSAcK=C00013418 | |KNApSAcK=C00013418 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAL 5,7,2',(3'),4',(5'),(6')-Hydroxyflavone O-methyl derivatives (73 pages) : FL3FALNI Non-cyclic prenyl substituted (21 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 170894-22-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FALNI0019.mol |
| Artocarpetin B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2- (4-hydroxy-2-methoxyphenyl) -7-methoxy-8- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C22H22O6 |
| Exact Mass | 382.141638436 |
| Average Mass | 382.40648000000004 |
| SMILES | c(c1C(O3)=CC(=O)c(c32)c(O)cc(c2CC=C(C)C)OC)cc(O)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
