FL3FAKNS0001
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7-Dihydroxy-2- (3-hydroxy-4,5-dimethoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Apometzgerin&&Tricetin 3',4'-dimethyl ether&&5,7-Dihydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&Apometzgerin&&Tricetin 3',4'-dimethyl ether&&5,7-Dihydroxy-2- (3-hydroxy-4,5-dimethoxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=76900-87-3 | |CAS=76900-87-3 | ||
|KNApSAcK=C00003915 | |KNApSAcK=C00003915 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAK Tricetin O-methyl derivatives (5,7-Hydroxy, without FL3FAH-FL3FAJ) (7 pages) : FL3FAKNS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76900-87-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAKNS0001.mol |
| Apometzgerin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-2- (3-hydroxy-4,5-dimethoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c1)c(OC)c(O)cc1C(=C2)Oc(c3)c(c(O)cc(O)3)C(=O)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
