FL3FADNI0001
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=6-Geranyl-5,7,4'-Trihydroxy-3'-methoxyflavone |
| − | |Common Name=&&Cannflavin A&& | + | |Common Name=&&Cannflavin A&&6-Geranyl-5,7,4'-Trihydroxy-3'-methoxyflavone&& |
|CAS=76735-57-4 | |CAS=76735-57-4 | ||
|KNApSAcK=C00004035 | |KNApSAcK=C00004035 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAD Chrysoeriol (62 pages) : FL3FADNI Non-cyclic prenyl substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76735-57-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FADNI0001.mol |
| Cannflavin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6-Geranyl-5,7,4'-Trihydroxy-3'-methoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C26H28O6 |
| Exact Mass | 436.188588628 |
| Average Mass | 436.49692 |
| SMILES | O(c23)C(=CC(c(c(O)c(c(O)c3)CC=C(CCC=C(C)C)C)2)=O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
