FL3FACGS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,3',4'-Tetrahydroxyflavone 7-O-(6"-malonylglucoside) | + | |SysName=5,7,3',4'-Tetrahydroxyflavone 7-O- (6"-malonylglucoside) |
| − | |Common Name=&&Luteolin 7-O-(6"-malonylglucoside)&&5,7,3',4'-Tetrahydroxyflavone 7-O-(6"-malonylglucoside)&& | + | |Common Name=&&Luteolin 7-O- (6"-malonylglucoside) &&5,7,3',4'-Tetrahydroxyflavone 7-O- (6"-malonylglucoside) && |
|CAS=98767-38-5 | |CAS=98767-38-5 | ||
|KNApSAcK=C00001067 | |KNApSAcK=C00001067 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 98767-38-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FACGS0001.mol |
| Luteolin 7-O- (6"-malonylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',4'-Tetrahydroxyflavone 7-O- (6"-malonylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C24H22O14 |
| Exact Mass | 534.100955412 |
| Average Mass | 534.42308 |
| SMILES | O=C(CC(O)=O)OCC(C(O)4)OC(C(C4O)O)Oc(c3)cc(c1c(O)3) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
