FL3FABGS0013
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7-Dihydroxy-4'-methoxyflavone 7-(6"-acetylglucoside) | + | |SysName=5,7-Dihydroxy-4'-methoxyflavone 7- (6"-acetylglucoside) |
| − | |Common Name=&&Acacetin 7-(6"-acetylglucoside)&&5,7-Dihydroxy-4'-methoxyflavone 7-(6"-acetylglucoside)&& | + | |Common Name=&&Acacetin 7- (6"-acetylglucoside) &&5,7-Dihydroxy-4'-methoxyflavone 7- (6"-acetylglucoside) && |
|CAS=76410-61-2 | |CAS=76410-61-2 | ||
|KNApSAcK=C00004245 | |KNApSAcK=C00004245 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76410-61-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FABGS0013.mol |
| Acacetin 7- (6"-acetylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-4'-methoxyflavone 7- (6"-acetylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C24H24O11 |
| Exact Mass | 488.13186161 |
| Average Mass | 488.44076 |
| SMILES | Oc(c1)c(C(=O)4)c(OC(=C4)c(c3)ccc(c3)OC)cc1OC(C2O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
