FL3FABGS0012
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 109517-74-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FABGS0012.mol |
Acacetin 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)] | |
---|---|
Structural Information | |
Systematic Name | Acacetin 7-rhamnosyl-(1->4")[glucosyl-(1->6")(6"'-acetylsophoroside)] |
Common Name |
|
Symbol | |
Formula | C42H54O25 |
Exact Mass | 958.2954172780001 |
Average Mass | 958.86316 |
SMILES | c(O6)(c(C(C=C6c(c7)ccc(c7)OC)=O)5)cc(cc(O)5)OC(O1) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|