FL3FA9NCN001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(-)-5,7-Dihydroxy-8-(1-methyl-2-pyrrolidinyl)flavone | + | |SysName= (-) -5,7-Dihydroxy-8- (1-methyl-2-pyrrolidinyl) flavone |
| − | |Common Name=&&Ficine&&(-)-5,7-Dihydroxy-8-(1-methyl-2-pyrrolidinyl)flavone&& | + | |Common Name=&&Ficine&& (-) -5,7-Dihydroxy-8- (1-methyl-2-pyrrolidinyl) flavone&& |
|CAS=2520-36-7 | |CAS=2520-36-7 | ||
|KNApSAcK=C00002339 | |KNApSAcK=C00002339 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 2520-36-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA9NCN001.mol |
| Ficine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (-) -5,7-Dihydroxy-8- (1-methyl-2-pyrrolidinyl) flavone |
| Common Name |
|
| Symbol | |
| Formula | C20H19NO4 |
| Exact Mass | 337.131408101 |
| Average Mass | 337.3692 |
| SMILES | c(c(O)2)(C(=O)4)c(OC(=C4)c(c3)cccc3)c(c(O)c2)C(C1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
