FL3FA9GS0002
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7-Dihydroxyflavone 7-glucoside |
| − | |Common Name=&&Aequinetin&& | + | |Common Name=&&Aequinetin&&5,7-Dihydroxyflavone 7-glucoside&& |
|CAS=31025-53-3 | |CAS=31025-53-3 | ||
|KNApSAcK=C00004110 | |KNApSAcK=C00004110 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FA9 5,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (53 pages) : FL3FA9GS O-Glycoside (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 31025-53-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA9GS0002.mol |
| Aequinetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxyflavone 7-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C21H20O9 |
| Exact Mass | 416.11073223799997 |
| Average Mass | 416.37809999999996 |
| SMILES | C(=C3)(c(c4)cccc4)Oc(c2C(=O)3)cc(cc(O)2)OC(O1)C(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
