FL3F39NF0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=9-Methoxy-7-phenyl-5H-furo[3,2-g][1]benzopyran-5-one | + | |SysName=9-Methoxy-7-phenyl-5H-furo [ 3,2-g ] [ 1 ] benzopyran-5-one |
| − | |Common Name=&&9-Methoxy-7-phenyl-5H-furo[3,2-g][1]benzopyran-5-one&& | + | |Common Name=&&9-Methoxy-7-phenyl-5H-furo [ 3,2-g ] [ 1 ] benzopyran-5-one&& |
|CAS=64803-88-9 | |CAS=64803-88-9 | ||
|KNApSAcK=C00013446 | |KNApSAcK=C00013446 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 64803-88-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F39NF0001.mol |
| 9-Methoxy-7-phenyl-5H-furo [ 3,2-g ] [ 1 ] benzopyran-5-one | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9-Methoxy-7-phenyl-5H-furo [ 3,2-g ] [ 1 ] benzopyran-5-one |
| Common Name |
|
| Symbol | |
| Formula | C18H12O4 |
| Exact Mass | 292.073558872 |
| Average Mass | 292.28548 |
| SMILES | c(c12)c(C(=O)4)c(OC(=C4)c(c3)cccc3)c(c1occ2)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
