FL3F19NF0004
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 51311-64-9 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3F19NF0004.mol |
Glabratephrin | |
---|---|
Structural Information | |
Systematic Name | Glabratephrin&&(3R,4R)-rel-(-)-4-(Acetyloxy)-4,5-dihydro-5,5-dimethyl-2'-phenylspiro[furan-3(2H),9'(8'H)-[4H]furo[2,3-h][1]benzopyran]-2,4'-dione |
Common Name |
|
Symbol | |
Formula | C24H20O7 |
Exact Mass | 420.120902994 |
Average Mass | 420.41139999999996 |
SMILES | C(=O)(C=4)c(c1OC(c(c5)cccc5)4)ccc(O3)c1C(C3)(C2=O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|