FL3F18NF0002
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(2,5-Dimethoxyphenyl)-4H-furo[2,3-h]-1-benzopyran-4-one | + | |SysName=2- (2,5-Dimethoxyphenyl) -4H-furo [ 2,3-h ] -1-benzopyran-4-one |
| − | |Common Name=&&Millettocalyxin C&&2-(2,5-Dimethoxyphenyl)-4H-furo[2,3-h]-1-benzopyran-4-one&& | + | |Common Name=&&Millettocalyxin C&&2- (2,5-Dimethoxyphenyl) -4H-furo [ 2,3-h ] -1-benzopyran-4-one&& |
|CAS=422308-57-4 | |CAS=422308-57-4 | ||
|KNApSAcK=C00013453 | |KNApSAcK=C00013453 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F18 7,2',(3'),(5'),(6')-Hydroxyflavone O-methyl derivatives (2 pages) : FL3F18NF Furanoflavonoid (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 422308-57-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F18NF0002.mol |
| Millettocalyxin C | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (2,5-Dimethoxyphenyl) -4H-furo [ 2,3-h ] -1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H14O5 |
| Exact Mass | 322.084123558 |
| Average Mass | 322.31146 |
| SMILES | c(c(C(O4)=CC(c(c43)ccc(c32)occ2)=O)1)(OC)ccc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
