FL2FCFNS0001
From Metabolomics.JP
(Difference between revisions)
| (7 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2- (3-Methoxy-4-methoxyphenyl) -7-methoxy-5-hydroxy-2,3-dihydro-4H-1-benzopyran-4-one |
| − | |Common Name=&&Eriodictyol 7,3',4'-trimethyl ether&& | + | |Common Name=&&Eriodictyol 7,3',4'-trimethyl ether&&2- (3-Methoxy-4-methoxyphenyl) -7-methoxy-5-hydroxy-2,3-dihydro-4H-1-benzopyran-4-one&& |
|CAS=70987-96-1 | |CAS=70987-96-1 | ||
|KNApSAcK=C00008349 | |KNApSAcK=C00008349 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FCF Eriodictyol 7,3',4'-trimethyl ether (1 pages) : FL2FCFNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 70987-96-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FCFNS0001.mol |
| Eriodictyol 7,3',4'-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3-Methoxy-4-methoxyphenyl) -7-methoxy-5-hydroxy-2,3-dihydro-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H18O6 |
| Exact Mass | 330.110338308 |
| Average Mass | 330.33191999999997 |
| SMILES | c(c21)(O)cc(OC)cc1OC(c(c3)cc(OC)c(OC)c3)CC2=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
