FL2FAANI0014
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(S)-2,3-Dihydro-4',5,7-trihydroxy-3'-(3-methyl-2-butenyl)flavone | + | |SysName= (S) -2,3-Dihydro-4',5,7-trihydroxy-3'- (3-methyl-2-butenyl) flavone |
| − | |Common Name=&&Licoflavanone&&(S)-2,3-Dihydro-4',5,7-trihydroxy-3'-(3-methyl-2-butenyl)flavone&& | + | |Common Name=&&Licoflavanone&& (S) -2,3-Dihydro-4',5,7-trihydroxy-3'- (3-methyl-2-butenyl) flavone&& |
|CAS=119240-82-3 | |CAS=119240-82-3 | ||
|KNApSAcK=C00008451 | |KNApSAcK=C00008451 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 119240-82-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FAANI0014.mol |
| Licoflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-4',5,7-trihydroxy-3'- (3-methyl-2-butenyl) flavone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | c(c1)(C(C2)Oc(c3)c(c(cc(O)3)O)C(=O)2)cc(c(O)c1)CC= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
