FL2FAANI0005
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(4-Hydroxyphenyl)-5,7-dihydroxy-8-(3-methyl-2-butenyl)-2,3-dihydro-4H-1-benzopyran-4-one | + | |SysName=2- (4-Hydroxyphenyl) -5,7-dihydroxy-8- (3-methyl-2-butenyl) -2,3-dihydro-4H-1-benzopyran-4-one |
| − | |Common Name=&&Sophoraflavanone B&& | + | |Common Name=&&8-Prenylnaringenin&&Sophoraflavanone B&&Flavaprenin&& |
| − | |CAS=72357-32-5 | + | |CAS=72357-32-5;53846-50-7 |
|KNApSAcK=C00008245 | |KNApSAcK=C00008245 | ||
}} | }} | ||
Latest revision as of 16:02, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAA Naringenin (106 pages) : FL2FAANI Non-cyclic prenyl substituted (26 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 72357-32-5;53846-50-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FAANI0005.mol |
| 8-Prenylnaringenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (4-Hydroxyphenyl) -5,7-dihydroxy-8- (3-methyl-2-butenyl) -2,3-dihydro-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | C(=O)(C2)c(c1OC2c(c3)ccc(O)c3)c(cc(O)c(CC=C(C)C)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
