FL2FA9NS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(S)-2,3-Dihydro-7-hydroxy-5-methoxy-2-phenyl-4H-1-benzopyran-4-one | + | |SysName= (S) -2,3-Dihydro-7-hydroxy-5-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| − | |Common Name=&&Alpinetin&&(S)-2,3-Dihydro-7-hydroxy-5-methoxy-2-phenyl-4H-1-benzopyran-4-one&& | + | |Common Name=&&Alpinetin&& (S) -2,3-Dihydro-7-hydroxy-5-methoxy-2-phenyl-4H-1-benzopyran-4-one&& |
|CAS=36052-37-6 | |CAS=36052-37-6 | ||
|KNApSAcK=C00008143 | |KNApSAcK=C00008143 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 36052-37-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NS0002.mol |
| Alpinetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-7-hydroxy-5-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C16H14O4 |
| Exact Mass | 270.089208936 |
| Average Mass | 270.27996 |
| SMILES | COc(c3)c(C(=O)2)c(cc(O)3)OC(C2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| [show] Species-Flavonoid Relationship Reported |
|---|
