FL2FA9NM0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=7-Hydroxy-5-methoxy-6-C-methylflavanone | |SysName=7-Hydroxy-5-methoxy-6-C-methylflavanone | ||
| − | |Common Name=&&Comptonin&& | + | |Common Name=&&Comptonin&&7-Hydroxy-5-methoxy-6-C-methylflavanone&& |
|CAS=60478-73-1 | |CAS=60478-73-1 | ||
|KNApSAcK=C00008164 | |KNApSAcK=C00008164 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 60478-73-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NM0002.mol |
| Comptonin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Hydroxy-5-methoxy-6-C-methylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O4 |
| Exact Mass | 284.104859 |
| Average Mass | 284.30654 |
| SMILES | COc(c(C)3)c(C(=O)2)c(cc(O)3)OC(C2)c(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
