FL2FA9NI0008
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=5-Hydroxy-7-methoxy-8-C-prenylflavanone |
|Common Name=&&Tephrinone&& | |Common Name=&&Tephrinone&& | ||
|CAS=75350-44-6 | |CAS=75350-44-6 | ||
|KNApSAcK=C00008177 | |KNApSAcK=C00008177 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 75350-44-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA9NI0008.mol |
| Tephrinone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C21H22O4 |
| Exact Mass | 338.151809192 |
| Average Mass | 338.39698 |
| SMILES | COc(c3)c(CC=C(C)C)c(c(c(O)3)2)OC(CC(=O)2)c(c1)cccc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
