FL2FA8NS0008
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,2'-Dihydroxy-7,5'-dimethoxyflavanone |
|Common Name=&&5,2'-Dihydroxy-7,5'-dimethoxyflavanone&& | |Common Name=&&5,2'-Dihydroxy-7,5'-dimethoxyflavanone&& | ||
|CAS=625111-94-6 | |CAS=625111-94-6 | ||
|KNApSAcK=C00014124 | |KNApSAcK=C00014124 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 625111-94-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA8NS0008.mol |
| 5,2'-Dihydroxy-7,5'-dimethoxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,2'-Dihydroxy-7,5'-dimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O6 |
| Exact Mass | 316.094688244 |
| Average Mass | 316.30534 |
| SMILES | COc(c3)cc(c(O)c3)C(C1)Oc(c2)c(c(O)cc(OC)2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
