FL1DQUNM0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2,2,4-Trimethyl-6-(1-oxo-3-phenylpropyl)-1,3,5-cyclohexanetrione | + | |SysName=2,2,4-Trimethyl-6- (1-oxo-3-phenylpropyl) -1,3,5-cyclohexanetrione |
| − | |Common Name=&&2,2,4-Trimethyl-6-(1-oxo-3-phenylpropyl)-1,3,5-cyclohexanetrione&& | + | |Common Name=&&2,2,4-Trimethyl-6- (1-oxo-3-phenylpropyl) -1,3,5-cyclohexanetrione&& |
|CAS=34328-57-9 | |CAS=34328-57-9 | ||
|KNApSAcK=C00007979 | |KNApSAcK=C00007979 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 34328-57-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DQUNM0001.mol |
| 2,2,4-Trimethyl-6- (1-oxo-3-phenylpropyl) -1,3,5-cyclohexanetrione | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,2,4-Trimethyl-6- (1-oxo-3-phenylpropyl) -1,3,5-cyclohexanetrione |
| Common Name |
|
| Symbol | |
| Formula | C18H20O4 |
| Exact Mass | 300.136159128 |
| Average Mass | 300.349 |
| SMILES | C(C(C2=O)C(C(C(C2C)=O)(C)C)=O)(=O)CCc(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
