FL1DA9NC0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=1-[2,4-Dihydroxy-3-[(2-hydroxyphenyl)methyl]-6-methoxyphenyl]-3-phenyl-1-propanone | + | |SysName=1- [ 2,4-Dihydroxy-3- [ (2-hydroxyphenyl) methyl ] -6-methoxyphenyl ] -3-phenyl-1-propanone |
| − | |Common Name=&&Uvaretin&&1-[2,4-Dihydroxy-3-[(2-hydroxyphenyl)methyl]-6-methoxyphenyl]-3-phenyl-1-propanone&& | + | |Common Name=&&Uvaretin&&1- [ 2,4-Dihydroxy-3- [ (2-hydroxyphenyl) methyl ] -6-methoxyphenyl ] -3-phenyl-1-propanone&& |
|CAS=58449-06-2 | |CAS=58449-06-2 | ||
|KNApSAcK=C00001012 | |KNApSAcK=C00001012 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 58449-06-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DA9NC0003.mol |
| Uvaretin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- [ 2,4-Dihydroxy-3- [ (2-hydroxyphenyl) methyl ] -6-methoxyphenyl ] -3-phenyl-1-propanone |
| Common Name |
|
| Symbol | |
| Formula | C23H22O5 |
| Exact Mass | 378.146723814 |
| Average Mass | 378.41778000000005 |
| SMILES | O(C)c(c2C(=O)CCc(c3)cccc3)cc(c(c2O)Cc(c1)c(ccc1)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
