FL1CUNNS0004
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 1 February 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 19956-54-8 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CUNNS0004.mol |
Methyllucidone | |
---|---|
Structural Information | |
Systematic Name | Methyllucidone |
Common Name |
|
Symbol | |
Formula | C16H14O4 |
Exact Mass | 270.089208936 |
Average Mass | 270.27996 |
SMILES | COC(=C1)C(=O)C(=C(OC)C=Cc(c2)cccc2)C(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|