FL1CHYNF0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=1-(4-Methoxybenzofuran-5-yl)-3-phenyl-1,3-propanedione |
|Common Name=&&Pongamol&& | |Common Name=&&Pongamol&& | ||
|CAS=484-33-3 | |CAS=484-33-3 | ||
|KNApSAcK=C00007018 | |KNApSAcK=C00007018 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 484-33-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CHYNF0003.mol |
Pongamol | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C18H14O4 |
Exact Mass | 294.089208936 |
Average Mass | 294.30136 |
SMILES | c(c23)(occ3)ccc(c2OC)C(=O)CC(=O)c(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|