FL1CA9NF0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Crassichalcone | + | |SysName=Crassichalcone |
|Common Name=&&Crassichalcone&&5"-Isopropenyl-4",5"-dihydrofurano[2",3":4',3']-2'-hydroxy-6'-methoxychalcone&& | |Common Name=&&Crassichalcone&&5"-Isopropenyl-4",5"-dihydrofurano[2",3":4',3']-2'-hydroxy-6'-methoxychalcone&& | ||
|CAS=260437-87-4 | |CAS=260437-87-4 | ||
|KNApSAcK=C00014443 | |KNApSAcK=C00014443 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 260437-87-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NF0003.mol |
| Crassichalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Crassichalcone |
| Common Name |
|
| Symbol | |
| Formula | C21H20O4 |
| Exact Mass | 336.136159128 |
| Average Mass | 336.38109999999995 |
| SMILES | COc(c2C(=O)C=Cc(c3)cccc3)cc(O1)c(c2O)CC1C(C)=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
