FL1CA9NF0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone |
|Common Name=&&Cedrediprenone&&2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone&& | |Common Name=&&Cedrediprenone&&2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone&& | ||
|CAS=554408-33-2 | |CAS=554408-33-2 | ||
|KNApSAcK=C00014442 | |KNApSAcK=C00014442 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 554408-33-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CA9NF0002.mol |
| Cedrediprenone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone |
| Common Name |
|
| Symbol | |
| Formula | C25H28O5 |
| Exact Mass | 408.193674006 |
| Average Mass | 408.48682 |
| SMILES | Oc(c(CC=C(C)C)2)c(C(=O)C=Cc(c3)cccc3)c(O1)c(c2O)CC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
