FL1CA9NF0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone |
|Common Name=&&Cedrediprenone&&2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone&& | |Common Name=&&Cedrediprenone&&2',4'-Dihydroxy-3'-prenyl-5"-(2-hydroxyisopropyl)-4",5"-dihydrofurano[2",3":6',5']chalcone&& | ||
|CAS=554408-33-2 | |CAS=554408-33-2 | ||
|KNApSAcK=C00014442 | |KNApSAcK=C00014442 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 554408-33-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CA9NF0002.mol |
Cedrediprenone | |
---|---|
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C25H28O5 |
Exact Mass | 408.193674006 |
Average Mass | 408.48682 |
SMILES | Oc(c(CC=C(C)C)2)c(C(=O)C=Cc(c3)cccc3)c(O1)c(c2O)CC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|