FL1C9ANS0003
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 193746-17-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C9ANS0003.mol |
| 4,2',5'-Trihydroxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4,2',5'-Trihydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O4 |
| Exact Mass | 256.073558872 |
| Average Mass | 256.25338 |
| SMILES | Oc(c2)ccc(c2)C=CC(=O)c(c1)c(O)ccc(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
