FL1C3CGS0007
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,4,2',3',4'-Pentahydroxychalcone 4'-(3",4",6"-triacetylglucoside) | + | |SysName=3,4,2',3',4'-Pentahydroxychalcone 4'- (3",4",6"-triacetylglucoside) |
| − | |Common Name=&&Okanin 4'-(3",4",6"-triacetylglucoside)&&3,4,2',3',4'-Pentahydroxychalcone 4'-(3",4",6"-triacetylglucoside)&& | + | |Common Name=&&Okanin 4'- (3",4",6"-triacetylglucoside) &&3,4,2',3',4'-Pentahydroxychalcone 4'- (3",4",6"-triacetylglucoside) && |
|CAS=135618-14-3 | |CAS=135618-14-3 | ||
|KNApSAcK=C00007898 | |KNApSAcK=C00007898 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 135618-14-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C3CGS0007.mol |
| Okanin 4'- (3",4",6"-triacetylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4,2',3',4'-Pentahydroxychalcone 4'- (3",4",6"-triacetylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C27H28O14 |
| Exact Mass | 576.147905604 |
| Average Mass | 576.50282 |
| SMILES | CC(=O)OC(C(OC(C)=O)3)C(O)C(OC3COC(C)=O)Oc(c2)c(O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
