FL1C3ANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=4,2',3',4'-Tetrahydroxychalcone |
|Common Name=&&4,2',3',4'-Tetrahydroxychalcone&& | |Common Name=&&4,2',3',4'-Tetrahydroxychalcone&& | ||
|CAS=- | |CAS=- | ||
|KNApSAcK=C00006948 | |KNApSAcK=C00006948 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C3ANS0001.mol |
| 4,2',3',4'-Tetrahydroxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4,2',3',4'-Tetrahydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O5 |
| Exact Mass | 272.068473494 |
| Average Mass | 272.25278000000003 |
| SMILES | Oc(c2)ccc(c2)C=CC(=O)c(c1)c(O)c(O)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
