FL1C29NS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(E)-1-(2,4-Dihydroxy-5-methoxyphenyl)-3-phenyl-2-propen-1-one | + | |SysName= (E) -1- (2,4-Dihydroxy-5-methoxyphenyl) -3-phenyl-2-propen-1-one |
| − | |Common Name=&&Flemichapparin&&(E)-1-(2,4-Dihydroxy-5-methoxyphenyl)-3-phenyl-2-propen-1-one&& | + | |Common Name=&&Flemichapparin&& (E) -1- (2,4-Dihydroxy-5-methoxyphenyl) -3-phenyl-2-propen-1-one&& |
|CAS=28143-82-0 | |CAS=28143-82-0 | ||
|KNApSAcK=C00006932 | |KNApSAcK=C00006932 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 28143-82-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C29NS0001.mol |
| Flemichapparin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- (2,4-Dihydroxy-5-methoxyphenyl) -3-phenyl-2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C16H14O4 |
| Exact Mass | 270.089208936 |
| Average Mass | 270.27996 |
| SMILES | COc(c1)c(O)cc(O)c1C(=O)C=Cc(c2)cccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
