FL1C1ANP0016
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3-Prenyl-6",6"-dimethylpyrano[2",3":4',3']-4,2'-dihydroxychalcone | + | |SysName=3-Prenyl-6",6"-dimethylpyrano [ 2",3":4',3' ] -4,2'-dihydroxychalcone |
| − | |Common Name=&&Paratocarpin B&&3-Prenyl-6",6"-dimethylpyrano[2",3":4',3']-4,2'-dihydroxychalcone&& | + | |Common Name=&&Paratocarpin B&&3-Prenyl-6",6"-dimethylpyrano [ 2",3":4',3' ] -4,2'-dihydroxychalcone&& |
|CAS=161099-57-6 | |CAS=161099-57-6 | ||
|KNApSAcK=C00014464 | |KNApSAcK=C00014464 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 161099-57-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANP0016.mol |
| Paratocarpin B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Prenyl-6",6"-dimethylpyrano [ 2",3":4',3' ] -4,2'-dihydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C25H26O4 |
| Exact Mass | 390.18310931999997 |
| Average Mass | 390.47153999999995 |
| SMILES | C(C=Cc(c3)cc(c(O)c3)CC=C(C)C)(=O)c(c1O)ccc(O2)c1C= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
