FL1C1ANP0015
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5-Prenyl-6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":4',3']-4,2'-dihydroxychalcone |
|Common Name=&&5-Prenyl-6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":4',3']-4,2'-dihydroxychalcone&&3',4'-(3-Hydroxy-2,2-dimethyldihydropyrano)-4,2'-dihydroxychalcone&& | |Common Name=&&5-Prenyl-6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":4',3']-4,2'-dihydroxychalcone&&3',4'-(3-Hydroxy-2,2-dimethyldihydropyrano)-4,2'-dihydroxychalcone&& | ||
|CAS=441772-65-2 | |CAS=441772-65-2 | ||
|KNApSAcK=C00014463 | |KNApSAcK=C00014463 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 441772-65-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANP0015.mol |
| 5-Prenyl-6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":4',3']-4,2'-dihydroxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Prenyl-6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":4',3']-4,2'-dihydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | Oc(c3)ccc(c3)C=CC(c(c(O)2)ccc(c21)OC(C)(C)C(O)C1)= |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
