FL1C1ANI0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(E)-1-[2-Hydroxy-4-[(3-methyl-2-butenyl)oxy]phenyl]-3-phenyl-2-propen-1-one | + | |SysName= (E) -1- [ 2-Hydroxy-4- [ (3-methyl-2-butenyl) oxy ] phenyl ] -3-phenyl-2-propen-1-one |
| − | |Common Name=&&Derricidin&&(E)-1-[2-Hydroxy-4-[(3-methyl-2-butenyl)oxy]phenyl]-3-phenyl-2-propen-1-one&& | + | |Common Name=&&Derricidin&& (E) -1- [ 2-Hydroxy-4- [ (3-methyl-2-butenyl) oxy ] phenyl ] -3-phenyl-2-propen-1-one&& |
|CAS=38965-74-1 | |CAS=38965-74-1 | ||
|KNApSAcK=C00007053 | |KNApSAcK=C00007053 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 38965-74-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANI0003.mol |
| Derricidin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- [ 2-Hydroxy-4- [ (3-methyl-2-butenyl) oxy ] phenyl ] -3-phenyl-2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C20H20O3 |
| Exact Mass | 308.141244506 |
| Average Mass | 308.371 |
| SMILES | c(c(C(=O)C=Cc(c2)cccc2)1)cc(cc(O)1)OCC=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
