FL1AACNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-4,6-dihydroxy-3(2H)-benzofuranone | + | |SysName=2- [ (Z) - (3,4-Dihydroxyphenyl) methylene ] -4,6-dihydroxy-3 (2H) -benzofuranone |
| − | |Common Name=&&Aureusidin&&2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-4,6-dihydroxy-3(2H)-benzofuranone&& | + | |Common Name=&&Aureusidin&&2- [ (Z) - (3,4-Dihydroxyphenyl) methylene ] -4,6-dihydroxy-3 (2H) -benzofuranone&& |
|CAS=480-70-6 | |CAS=480-70-6 | ||
|KNApSAcK=C00008027 | |KNApSAcK=C00008027 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 480-70-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1AACNS0001.mol |
| Aureusidin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- [ (Z) - (3,4-Dihydroxyphenyl) methylene ] -4,6-dihydroxy-3 (2H) -benzofuranone |
| Common Name |
|
| Symbol | |
| Formula | C15H10O6 |
| Exact Mass | 286.047738052 |
| Average Mass | 286.2363 |
| SMILES | Oc(c3)cc(o1)c(c(O)3)c(=O)c(=Cc(c2)cc(O)c(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
