FL1A3CGS0010
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=6,7,3',4'-Tetrahydroxyaurone 6-O-(3",6"-di-O-acetylglucoside) |
|Common Name=&&Bidenoside A&&6,7,3',4'-Tetrahydroxyaurone 6-O-(3",6"-di-O-acetylglucoside)&&Maritimetin 6-O-(3",6"-di-O-acetylglucoside)&& | |Common Name=&&Bidenoside A&&6,7,3',4'-Tetrahydroxyaurone 6-O-(3",6"-di-O-acetylglucoside)&&Maritimetin 6-O-(3",6"-di-O-acetylglucoside)&& | ||
|CAS=698392-68-6 | |CAS=698392-68-6 | ||
|KNApSAcK=C00014666 | |KNApSAcK=C00014666 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 698392-68-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1A3CGS0010.mol |
| Bidenoside A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6,7,3',4'-Tetrahydroxyaurone 6-O-(3",6"-di-O-acetylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C25H24O13 |
| Exact Mass | 532.121690854 |
| Average Mass | 532.45026 |
| SMILES | C(C1Oc(c(O)2)ccc(c(=O)3)c(oc3=Cc(c4)cc(c(O)c4)O)2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
