Eleutheroside B
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=4-[(1E)-3-Hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl .beta.-D-glucopyranoside |Common Name=&&Syringin&&(E)-4-(3-Hydroxy-1-propenyl)-2,6-di...) |
|||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=4-[(1E)-3-Hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl | + | |SysName=4-[(1E)-3-Hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl beta-D-glucopyranoside |
| − | |Common Name=&&Syringin&&(E)-4-(3-Hydroxy-1-propenyl)-2,6-dimethoxyphenyl | + | |Common Name=&&Eleutheroside B&&Syringin&&(E)-4-(3-Hydroxy-1-propenyl)-2,6-dimethoxyphenyl beta-D-glucopyranoside&&4-[(1E)-3-Hydroxy-1-propenyl]-2,6-dimethoxyphenyl beta-D-glucopyranoside&&Ilexanthin A&&Ligustrin&&Lilacin&&Magnolenin&&Methoxyconiferine&&Sinapyl alcohol 4-O-glucoside&&Siringin&&Syringoside&& |
|CAS=118-34-3 | |CAS=118-34-3 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 16:08, 18 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 118-34-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Eleutheroside B.mol |
| Eleutheroside B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 4-[(1E)-3-Hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl beta-D-glucopyranoside |
| Common Name |
|
| Symbol | |
| Formula | C17H24O9 |
| Exact Mass | 372.14203236599997 |
| Average Mass | 372.36706 |
| SMILES | OCC=Cc(c1)cc(OC)c(OC(O2)C(O)C(O)C(O)C(CO)2)c(OC)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
