Eleutheroside B
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=4-[(1E)-3-Hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl .beta.-D-glucopyranoside |Common Name=&&Syringin&&(E)-4-(3-Hydroxy-1-propenyl)-2,6-di...) |
Revision as of 09:55, 11 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 118-34-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Eleutheroside B.mol |
Syringin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 4-[(1E)-3-Hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl .beta.-D-glucopyranoside |
Common Name |
|
Symbol | |
Formula | C17H24O9 |
Exact Mass | 372.14203236599997 |
Average Mass | 372.36706 |
SMILES | OCC=Cc(c1)cc(OC)c(OC(O2)C(O)C(O)C(O)C(CO)2)c(OC)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |