Dimethylesculetin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=6,7-Dimethoxy-2H-1-benzopyran-2-one |Common Name=&&6,7-Dimethoxy-coumarin&&6,7-Dimethoxycoumarin&&6,7-Dimethylesculetin&&Aesculetin dimeth...) |
Revision as of 09:53, 9 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 120-08-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Dimethylesculetin.mol |
6,7-Dimethoxy-coumarin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6,7-Dimethoxy-2H-1-benzopyran-2-one |
Common Name |
|
Symbol | |
Formula | C11H10O4 |
Exact Mass | 206.05790880799998 |
Average Mass | 206.1947 |
SMILES | COc(c1)c(OC)cc(O2)c(C=CC(=O)2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |