Dihydrocapsaicin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-Methyl-, nonanamide |Common Name=&&Dihydrocapsaicin&&8-Methyl-N-vanillyl-, nonanamide&&6,7-Dihydr...) |
Revision as of 16:18, 14 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 19408-84-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Dihydrocapsaicin.mol |
| Dihydrocapsaicin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-Methyl-, nonanamide |
| Common Name |
|
| Symbol | |
| Formula | C18H29NO3 |
| Exact Mass | 307.21474379899996 |
| Average Mass | 307.4278 |
| SMILES | CC(C)CCCCCCC(=O)NCc(c1)cc(OC)c(O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
