Capsaicin
From Metabolomics.JP
(Difference between revisions)
(2 intermediate revisions by one user not shown) | |||
Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(6E)- | + | |SysName=(6E)-N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide |
− | |Common Name=&&Capsaicin&&(E)- | + | |Common Name=&&Capsaicin&&(E)-8-Methyl-N-vanillyl-6-nonenamide&&(E)-N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide&&(E)-N-(4-Hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide&&Capsaicine&&E-Capsaicin&&N-(4-Oxy-3-methoxybenzyl)-8-methyl-6-nonenamide&&trans-8-Methyl-N-vanillyl-6-nonenamide&& |
|CAS=404-86-4 | |CAS=404-86-4 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} |
Latest revision as of 12:37, 19 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 404-86-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Capsaicin.mol |
Capsaicin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (6E)-N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyl-6-nonenamide |
Common Name |
|
Symbol | |
Formula | C18H27NO3 |
Exact Mass | 305.199093735 |
Average Mass | 305.41192 |
SMILES | CC(C)C=CCCCCC(=O)NCc(c1)cc(OC)c(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |