Bisdemethoxycurcumin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione |Common Name=&&(E,E)-1,7-Bis(p-hydroxyphenyl)-1,6-heptadiene-3,5-dione&&(1E,6E)-...) |
Revision as of 10:07, 9 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 33171-05-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Bisdemethoxycurcumin.mol |
(E,E)-1,7-Bis(p-hydroxyphenyl)-1,6-heptadiene-3,5-dione | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione |
Common Name |
|
Symbol | |
Formula | C19H16O4 |
Exact Mass | 308.104859 |
Average Mass | 308.32794 |
SMILES | Oc(c1)ccc(C=CC(=O)CC(=O)C=Cc(c2)ccc(O)c2)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |