Beta-Eudesmol
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(2R,4aR,8aS)-Decahydro-.alpha.,.alpha.,4a-trimethyl-8-methylene-2-naphthalenemethanol |Common Name=&&1,2.alpha.,3,4,4a,5,6,7,8,8a.alpha.-D...) |
|||
| (One intermediate revision by one user not shown) | |||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R,4aR,8aS)-Decahydro- | + | |SysName=(2R,4aR,8aS)-Decahydro-alpha,alpha,4a-trimethyl-8-methylene-2-naphthalenemethanol |
| − | |Common Name=&&1, | + | |Common Name=&&beta-Eudesmol&&1,2alpha,3,4,4a,5,6,7,8,8aalpha-Decahydro-alpha,alpha,4abeta-trimethyl-8-methylene-2-naphthalenemethanol&&[2R-(2alpha,4aalpha,8abeta)]-Decahydro-alpha,alpha,4a-trimethyl-8-methylene-2-naphthalenemethanol&&Eudesm-4(14)-en-11-ol&&(+)-beta-Eudesmol&&beta-Selinenol&& |
|CAS=473-15-4 | |CAS=473-15-4 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 12:27, 19 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 473-15-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Beta-Eudesmol.mol |
| beta-Eudesmol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,4aR,8aS)-Decahydro-alpha,alpha,4a-trimethyl-8-methylene-2-naphthalenemethanol |
| Common Name |
|
| Symbol | |
| Formula | C15H26O |
| Exact Mass | 222.198365454 |
| Average Mass | 222.36634 |
| SMILES | CC(C)(O)C(C1)CC([H])(C(=C)2)C(C)(CCC2)C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
