BMXXBX--f004
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				Revision as of 09:00, 8 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 97-77-8 | 
| KEGG | C01692 | 
| KNApSAcK | |
| CDX file | |
| MOL file | BMXXBX--f004.mol | 
| Disulfiram | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | Disulfiram | 
| Common Name | 
 | 
| Symbol | |
| Formula | C10H20N2S4 | 
| Exact Mass | 296.0509 | 
| Average Mass | 296.5432 | 
| SMILES | CCN(CC)C(=S)SSC(=S)N(CC)CC | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
