BMMCPYCTm014
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 10159-38-3 |
KEGG | C05673 |
KNApSAcK | |
CDX file | |
MOL file | BMMCPYCTm014.mol |
CMP-2-aminoethylphosphonate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | CMP-ciliatine |
Common Name |
|
Symbol | |
Formula | C11H20N4O10P2 |
Exact Mass | 430.0654 |
Average Mass | 430.2449 |
SMILES | NCCP(O)(=O)OP(O)(=O)OC[C@@H](O1)[C@@H](O)[C@@H](O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |