BMMCPD--k002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C03340 |
KNApSAcK | |
CDX file | |
MOL file | BMMCPD--k002.mol |
L-2,3-Dihydrodipicolinate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2,3-Dihydro-dipicolinic acid |
Common Name |
|
Symbol | |
Formula | C7H7NO4 |
Exact Mass | 169.0375 |
Average Mass | 169.1348 |
SMILES | OC(=O)C(C1)N=C(C=C1)C(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways