BMMCHC--k021
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | ? |
KEGG | C06657 |
KNApSAcK | |
CDX file | |
MOL file | BMMCHC--k021.mol |
Guanidinoproclavaminic acid | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Guanidino-proclavaminic acid |
Common Name |
|
Symbol | |
Formula | C9H16N4O4 |
Exact Mass | 244.1171 |
Average Mass | 244.2479 |
SMILES | NC(=N)NCC[C@@H](O)[C@@H](C(O)=O)N(C1)C(=O)C1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways