BMMCHC--e010
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 8 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 143488-44-2 |
| KEGG | C11453 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMMCHC--e010.mol |
| 2-C-Methyl-D-erythritol 2,4-cyclodiphosphate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2-C-methyl-D-erythritol 2,4-cyclodiphosphate |
| Common Name |
|
| Symbol | |
| Formula | C5H12O9P2 |
| Exact Mass | 277.9956 |
| Average Mass | 278.0909 |
| SMILES | OC[C@](C)([C@H](O)1)OP(O)(=O)OP(O)(=O)OC1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
